50608-99-6 Usage
Uses
Used in Pharmaceutical Industry:
3-AMINO-PYRIDINE-2-CARBOXYLIC ACID AMIDE is used as a pharmaceutical intermediate for its potential biological activity. It plays a crucial role in the synthesis of various pharmaceuticals, contributing to the development of new drugs with therapeutic benefits.
Used in Agrochemicals:
In the agrochemical sector, 3-AMINO-PYRIDINE-2-CARBOXYLIC ACID AMIDE is utilized as a key component in the creation of agrochemicals. Its incorporation aids in enhancing the effectiveness of these products, supporting agricultural productivity and crop protection.
Used in Dyes:
3-AMINO-PYRIDINE-2-CARBOXYLIC ACID AMIDE is used as a precursor in the synthesis of dyes. Its chemical properties allow for the development of dyes with specific color characteristics and stability, catering to various industrial needs.
Used in Organic Synthesis:
As a building block in organic synthesis, 3-AMINO-PYRIDINE-2-CARBOXYLIC ACID AMIDE is employed for constructing complex organic molecules. Its versatile reactivity and functional groups make it a valuable component in the synthesis of a wide range of organic compounds.
Used in Research Applications:
3-AMINO-PYRIDINE-2-CARBOXYLIC ACID AMIDE is also used in research settings to explore its chemical properties and potential interactions with other molecules. This research can lead to new discoveries and applications in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 50608-99-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,6,0 and 8 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 50608-99:
(7*5)+(6*0)+(5*6)+(4*0)+(3*8)+(2*9)+(1*9)=116
116 % 10 = 6
So 50608-99-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3O/c7-4-2-1-3-9-5(4)6(8)10/h1-3H,7H2,(H2,8,10)
